About 7-fluoro-1-methyl-N'-prop-2-enyl-1,2-dihydrobenzo[e]indole-3-carboximidamide
7-fluoro-1-methyl-N'-prop-2-enyl-1,2-dihydrobenzo[e]indole-3-carboximidamide (PubChem CID 155408390) has the molecular formula C17H18FN3
and a molecular weight of 283.35 g/mol. Its IUPAC name is 7-fluoro-1-methyl-N'-prop-2-enyl-1,2-dihydrobenzo[e]indole-3-carboximidamide.
Molecular Properties
| Compound Name | 7-fluoro-1-methyl-N'-prop-2-enyl-1,2-dihydrobenzo[e]indole-3-carboximidamide |
| PubChem CID | 155408390 |
| Molecular Formula | C17H18FN3 |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 7-fluoro-1-methyl-N'-prop-2-enyl-1,2-dihydrobenzo[e]indole-3-carboximidamide |
| SMILES | C=CC/N=C(\N)N1CC(C)c2c1ccc1cc(F)ccc21 |
| InChI | InChI=1S/C17H18FN3/c1-3-8-20-17(19)21-10-11(2)16-14-6-5-13(18)9-12(14)4-7-15(16)21/h3-7,9,11H,1,8,10H2,2H3,(H2,19,20) |
| InChIKey | QGBRHZQWRBZDLC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-fluoro-1-methyl-N'-prop-2-enyl-1,2-dihydrobenzo[e]indole-3-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-1-methyl-N'-prop-2-enyl-1,2-dihydrobenzo[e]indole-3-carboximidamide?
The IUPAC name of 7-fluoro-1-methyl-N'-prop-2-enyl-1,2-dihydrobenzo[e]indole-3-carboximidamide (CID 155408390) is 7-fluoro-1-methyl-N'-prop-2-enyl-1,2-dihydrobenzo[e]indole-3-carboximidamide.
What is the SMILES notation for 7-fluoro-1-methyl-N'-prop-2-enyl-1,2-dihydrobenzo[e]indole-3-carboximidamide?
The canonical SMILES for 7-fluoro-1-methyl-N'-prop-2-enyl-1,2-dihydrobenzo[e]indole-3-carboximidamide is C=CC/N=C(\N)N1CC(C)c2c1ccc1cc(F)ccc21.
What is the InChIKey of 7-fluoro-1-methyl-N'-prop-2-enyl-1,2-dihydrobenzo[e]indole-3-carboximidamide?
The InChIKey is QGBRHZQWRBZDLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18FN3/c1-3-8-20-17(19)21-10-11(2)16-14-6-5-13(18)9-12(14)4-7-15(16)21/h3-7,9,11H,1,8,10H2,2H3,(H2,19,20).
What are the key properties of 7-fluoro-1-methyl-N'-prop-2-enyl-1,2-dihydrobenzo[e]indole-3-carboximidamide?
7-fluoro-1-methyl-N'-prop-2-enyl-1,2-dihydrobenzo[e]indole-3-carboximidamide has a molecular weight of 283.35 g/mol, XLogP of 3.40, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-1-methyl-N'-prop-2-enyl-1,2-dihydrobenzo[e]indole-3-carboximidamide is sourced from PubChem (CID 155408390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).