About 7-fluoro-N',1-dimethyl-1,2-dihydrobenzo[e]indole-3-carboximidamide
7-fluoro-N',1-dimethyl-1,2-dihydrobenzo[e]indole-3-carboximidamide (PubChem CID 155408420) has the molecular formula C15H16FN3
and a molecular weight of 257.31 g/mol. Its IUPAC name is 7-fluoro-N',1-dimethyl-1,2-dihydrobenzo[e]indole-3-carboximidamide.
Molecular Properties
| Compound Name | 7-fluoro-N',1-dimethyl-1,2-dihydrobenzo[e]indole-3-carboximidamide |
| PubChem CID | 155408420 |
| Molecular Formula | C15H16FN3 |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 7-fluoro-N',1-dimethyl-1,2-dihydrobenzo[e]indole-3-carboximidamide |
| SMILES | C/N=C(\N)N1CC(C)c2c1ccc1cc(F)ccc21 |
| InChI | InChI=1S/C15H16FN3/c1-9-8-19(15(17)18-2)13-6-3-10-7-11(16)4-5-12(10)14(9)13/h3-7,9H,8H2,1-2H3,(H2,17,18) |
| InChIKey | RNUHBMCEAOPMCB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 7-fluoro-N',1-dimethyl-1,2-dihydrobenzo[e]indole-3-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-N',1-dimethyl-1,2-dihydrobenzo[e]indole-3-carboximidamide?
The IUPAC name of 7-fluoro-N',1-dimethyl-1,2-dihydrobenzo[e]indole-3-carboximidamide (CID 155408420) is 7-fluoro-N',1-dimethyl-1,2-dihydrobenzo[e]indole-3-carboximidamide.
What is the SMILES notation for 7-fluoro-N',1-dimethyl-1,2-dihydrobenzo[e]indole-3-carboximidamide?
The canonical SMILES for 7-fluoro-N',1-dimethyl-1,2-dihydrobenzo[e]indole-3-carboximidamide is C/N=C(\N)N1CC(C)c2c1ccc1cc(F)ccc21.
What is the InChIKey of 7-fluoro-N',1-dimethyl-1,2-dihydrobenzo[e]indole-3-carboximidamide?
The InChIKey is RNUHBMCEAOPMCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16FN3/c1-9-8-19(15(17)18-2)13-6-3-10-7-11(16)4-5-12(10)14(9)13/h3-7,9H,8H2,1-2H3,(H2,17,18).
What are the key properties of 7-fluoro-N',1-dimethyl-1,2-dihydrobenzo[e]indole-3-carboximidamide?
7-fluoro-N',1-dimethyl-1,2-dihydrobenzo[e]indole-3-carboximidamide has a molecular weight of 257.31 g/mol, XLogP of 2.85, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-N',1-dimethyl-1,2-dihydrobenzo[e]indole-3-carboximidamide is sourced from PubChem (CID 155408420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).