About 5,6-difluoro-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide
5,6-difluoro-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide (PubChem CID 155408460) has the molecular formula C14H13F2N3
and a molecular weight of 261.27 g/mol. Its IUPAC name is 5,6-difluoro-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide.
Molecular Properties
| Compound Name | 5,6-difluoro-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide |
| PubChem CID | 155408460 |
| Molecular Formula | C14H13F2N3 |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 5,6-difluoro-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide |
| SMILES | [H]/N=C(\N)N1CC(C)c2c1cc(F)c1c(F)cccc21 |
| InChI | InChI=1S/C14H13F2N3/c1-7-6-19(14(17)18)11-5-10(16)13-8(12(7)11)3-2-4-9(13)15/h2-5,7H,6H2,1H3,(H3,17,18) |
| InChIKey | DCBHFRKVDIRPSB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5,6-difluoro-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-difluoro-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide?
The IUPAC name of 5,6-difluoro-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide (CID 155408460) is 5,6-difluoro-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide.
What is the SMILES notation for 5,6-difluoro-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide?
The canonical SMILES for 5,6-difluoro-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide is [H]/N=C(\N)N1CC(C)c2c1cc(F)c1c(F)cccc21.
What is the InChIKey of 5,6-difluoro-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide?
The InChIKey is DCBHFRKVDIRPSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13F2N3/c1-7-6-19(14(17)18)11-5-10(16)13-8(12(7)11)3-2-4-9(13)15/h2-5,7H,6H2,1H3,(H3,17,18).
What are the key properties of 5,6-difluoro-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide?
5,6-difluoro-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide has a molecular weight of 261.27 g/mol, XLogP of 2.93, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-difluoro-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide is sourced from PubChem (CID 155408460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).