C12H18O6 — CID 155408606
(4R)-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclobutane]-1'-carboxylic acid (PubChem CID 155408606) has the molecular formula C12H18O6 and a molecular weight of 258.27 g/mol. Its IUPAC name is (4R)-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclobutane]-1'-carboxylic acid.
| Compound Name | (4R)-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclobutane]-1'-carboxylic acid |
|---|---|
| PubChem CID | 155408606 |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | (4R)-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclobutane]-1'-carboxylic acid |
| SMILES | COC1O[C@@]2(CCC2C(=O)O)C2OC(C)(C)OC12 |
| InChI | InChI=1S/C12H18O6/c1-11(2)16-7-8(17-11)12(18-10(7)15-3)5-4-6(12)9(13)14/h6-8,10H,4-5H2,1-3H3,(H,13,14)/t6?,7?,8?,10?,12-/m1/s1 |
| InChIKey | CCQXXFZGQNKYMS-RTVVSXBSSA-N |
| XLogP | 0.74 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |