C18H22O5S — CID 155409101
(3aS,6R,6aR)-6-methoxy-2,2-dimethyl-4'-(phenylsulfanylmethyl)spiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclobutane]-1'-one (PubChem CID 155409101) has the molecular formula C18H22O5S and a molecular weight of 350.44 g/mol. Its IUPAC name is (3aS,6R,6aR)-6-methoxy-2,2-dimethyl-4'-(phenylsulfanylmethyl)spiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclobutane]-1'-one.
| Compound Name | (3aS,6R,6aR)-6-methoxy-2,2-dimethyl-4'-(phenylsulfanylmethyl)spiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclobutane]-1'-one |
|---|---|
| PubChem CID | 155409101 |
| Molecular Formula | C18H22O5S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | (3aS,6R,6aR)-6-methoxy-2,2-dimethyl-4'-(phenylsulfanylmethyl)spiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclobutane]-1'-one |
| SMILES | CO[C@@H]1OC2(CC(CSc3ccccc3)C2=O)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C18H22O5S/c1-17(2)21-13-15(22-17)18(23-16(13)20-3)9-11(14(18)19)10-24-12-7-5-4-6-8-12/h4-8,11,13,15-16H,9-10H2,1-3H3/t11?,13-,15+,16-,18?/m1/s1 |
| InChIKey | IMQOZVGCBAWKOT-DNHLGGILSA-N |
| XLogP | 2.63 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |