C31H29N5O5 — CID 155409126
N-ethyl-2-oxo-2-[(3S,23E)-5-oxo-21,26-dioxa-4,10,12,33-tetrazapentacyclo[25.2.2.112,15.116,20.06,11]tritriaconta-1(30),6(11),7,9,13,15(33),16(32),17,19,23,27(31),28-dodecaen-3-yl]acetamide (PubChem CID 155409126) has the molecular formula C31H29N5O5 and a molecular weight of 551.60 g/mol. Its IUPAC name is N-ethyl-2-oxo-2-[(3S,23E)-5-oxo-21,26-dioxa-4,10,12,33-tetrazapentacyclo[25.2.2.112,15.116,20.06,11]tritriaconta-1(30),6(11),7,9,13,15(33),16(32),17,19,23,27(31),28-dodecaen-3-yl]acetamide.
| Compound Name | N-ethyl-2-oxo-2-[(3S,23E)-5-oxo-21,26-dioxa-4,10,12,33-tetrazapentacyclo[25.2.2.112,15.116,20.06,11]tritriaconta-1(30),6(11),7,9,13,15(33),16(32),17,19,23,27(31),28-dodecaen-3-yl]acetamide |
|---|---|
| PubChem CID | 155409126 |
| Molecular Formula | C31H29N5O5 |
| Molecular Weight | 551.60 g/mol |
| Exact Mass | 551.22 |
| IUPAC Name | N-ethyl-2-oxo-2-[(3S,23E)-5-oxo-21,26-dioxa-4,10,12,33-tetrazapentacyclo[25.2.2.112,15.116,20.06,11]tritriaconta-1(30),6(11),7,9,13,15(33),16(32),17,19,23,27(31),28-dodecaen-3-yl]acetamide |
| SMILES | CCNC(=O)C(=O)[C@@H]1Cc2ccc(cc2)OC/C=C/COc2cccc(c2)-c2ccn(n2)-c2ncccc2C(=O)N1 |
| InChI | InChI=1S/C31H29N5O5/c1-2-32-31(39)28(37)27-19-21-10-12-23(13-11-21)40-17-3-4-18-41-24-8-5-7-22(20-24)26-14-16-36(35-26)29-25(30(38)34-27)9-6-15-33-29/h3-16,20,27H,2,17-19H2,1H3,(H,32,39)(H,34,38)/b4-3+/t27-/m0/s1 |
| InChIKey | BKJAJXRNYXQJAM-BAJJQUEBSA-N |
| XLogP | 3.31 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.60 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|