About 4-[3-(1,2-oxazol-5-yl)butan-2-yl]-1,3-oxazole
4-[3-(1,2-oxazol-5-yl)butan-2-yl]-1,3-oxazole (PubChem CID 155409140) has the molecular formula C10H12N2O2
and a molecular weight of 192.22 g/mol. Its IUPAC name is 4-[3-(1,2-oxazol-5-yl)butan-2-yl]-1,3-oxazole.
Molecular Properties
| Compound Name | 4-[3-(1,2-oxazol-5-yl)butan-2-yl]-1,3-oxazole |
| PubChem CID | 155409140 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 4-[3-(1,2-oxazol-5-yl)butan-2-yl]-1,3-oxazole |
| SMILES | CC(c1cocn1)C(C)c1ccno1 |
| InChI | InChI=1S/C10H12N2O2/c1-7(9-5-13-6-11-9)8(2)10-3-4-12-14-10/h3-8H,1-2H3 |
| InChIKey | GGLNGMWSAYANGP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[3-(1,2-oxazol-5-yl)butan-2-yl]-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(1,2-oxazol-5-yl)butan-2-yl]-1,3-oxazole?
The IUPAC name of 4-[3-(1,2-oxazol-5-yl)butan-2-yl]-1,3-oxazole (CID 155409140) is 4-[3-(1,2-oxazol-5-yl)butan-2-yl]-1,3-oxazole.
What is the SMILES notation for 4-[3-(1,2-oxazol-5-yl)butan-2-yl]-1,3-oxazole?
The canonical SMILES for 4-[3-(1,2-oxazol-5-yl)butan-2-yl]-1,3-oxazole is CC(c1cocn1)C(C)c1ccno1.
What is the InChIKey of 4-[3-(1,2-oxazol-5-yl)butan-2-yl]-1,3-oxazole?
The InChIKey is GGLNGMWSAYANGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2/c1-7(9-5-13-6-11-9)8(2)10-3-4-12-14-10/h3-8H,1-2H3.
What are the key properties of 4-[3-(1,2-oxazol-5-yl)butan-2-yl]-1,3-oxazole?
4-[3-(1,2-oxazol-5-yl)butan-2-yl]-1,3-oxazole has a molecular weight of 192.22 g/mol, XLogP of 2.57, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(1,2-oxazol-5-yl)butan-2-yl]-1,3-oxazole is sourced from PubChem (CID 155409140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).