About 3-ethoxy-5-iodo-1H-1,2,4-triazole
3-ethoxy-5-iodo-1H-1,2,4-triazole (PubChem CID 155409207) has the molecular formula C4H6IN3O
and a molecular weight of 239.02 g/mol. Its IUPAC name is 3-ethoxy-5-iodo-1H-1,2,4-triazole.
Molecular Properties
| Compound Name | 3-ethoxy-5-iodo-1H-1,2,4-triazole |
| PubChem CID | 155409207 |
| Molecular Formula | C4H6IN3O |
| Molecular Weight | 239.02 g/mol |
| Exact Mass | 238.96 |
| IUPAC Name | 3-ethoxy-5-iodo-1H-1,2,4-triazole |
| SMILES | CCOc1n[nH]c(I)n1 |
| InChI | InChI=1S/C4H6IN3O/c1-2-9-4-6-3(5)7-8-4/h2H2,1H3,(H,6,7,8) |
| InChIKey | IOUBZDHZMZMMJR-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.02 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-ethoxy-5-iodo-1H-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-5-iodo-1H-1,2,4-triazole?
The IUPAC name of 3-ethoxy-5-iodo-1H-1,2,4-triazole (CID 155409207) is 3-ethoxy-5-iodo-1H-1,2,4-triazole.
What is the SMILES notation for 3-ethoxy-5-iodo-1H-1,2,4-triazole?
The canonical SMILES for 3-ethoxy-5-iodo-1H-1,2,4-triazole is CCOc1n[nH]c(I)n1.
What is the InChIKey of 3-ethoxy-5-iodo-1H-1,2,4-triazole?
The InChIKey is IOUBZDHZMZMMJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6IN3O/c1-2-9-4-6-3(5)7-8-4/h2H2,1H3,(H,6,7,8).
What are the key properties of 3-ethoxy-5-iodo-1H-1,2,4-triazole?
3-ethoxy-5-iodo-1H-1,2,4-triazole has a molecular weight of 239.02 g/mol, XLogP of 0.81, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-5-iodo-1H-1,2,4-triazole is sourced from PubChem (CID 155409207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).