C27H24N4O5 — CID 155409217
methyl (21Z)-5-oxo-19,24-dioxa-4,10,12,31-tetrazapentacyclo[23.2.2.112,15.114,18.06,11]hentriaconta-1(28),6(11),7,9,13,15(31),16,18(30),21,25(29),26-undecaene-3-carboxylate (PubChem CID 155409217) has the molecular formula C27H24N4O5 and a molecular weight of 484.51 g/mol. Its IUPAC name is methyl (21Z)-5-oxo-19,24-dioxa-4,10,12,31-tetrazapentacyclo[23.2.2.112,15.114,18.06,11]hentriaconta-1(28),6(11),7,9,13,15(31),16,18(30),21,25(29),26-undecaene-3-carboxylate.
| Compound Name | methyl (21Z)-5-oxo-19,24-dioxa-4,10,12,31-tetrazapentacyclo[23.2.2.112,15.114,18.06,11]hentriaconta-1(28),6(11),7,9,13,15(31),16,18(30),21,25(29),26-undecaene-3-carboxylate |
|---|---|
| PubChem CID | 155409217 |
| Molecular Formula | C27H24N4O5 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | methyl (21Z)-5-oxo-19,24-dioxa-4,10,12,31-tetrazapentacyclo[23.2.2.112,15.114,18.06,11]hentriaconta-1(28),6(11),7,9,13,15(31),16,18(30),21,25(29),26-undecaene-3-carboxylate |
| SMILES | COC(=O)C1Cc2ccc(cc2)OC/C=C\COc2ccc3nn(cc3c2)-c2ncccc2C(=O)N1 |
| InChI | InChI=1S/C27H24N4O5/c1-34-27(33)24-15-18-6-8-20(9-7-18)35-13-2-3-14-36-21-10-11-23-19(16-21)17-31(30-23)25-22(26(32)29-24)5-4-12-28-25/h2-12,16-17,24H,13-15H2,1H3,(H,29,32)/b3-2- |
| InChIKey | HKOUDKXZGOZSGR-IHWYPQMZSA-N |
| XLogP | 3.26 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|