C26H22N4O4 — CID 155409242
(3S,21Z)-5-oxo-19,24-dioxa-4,10,12,31-tetrazapentacyclo[23.2.2.112,15.114,18.06,11]hentriaconta-1(28),6(11),7,9,13,15(31),16,18(30),21,25(29),26-undecaene-3-carbaldehyde (PubChem CID 155409242) has the molecular formula C26H22N4O4 and a molecular weight of 454.49 g/mol. Its IUPAC name is (3S,21Z)-5-oxo-19,24-dioxa-4,10,12,31-tetrazapentacyclo[23.2.2.112,15.114,18.06,11]hentriaconta-1(28),6(11),7,9,13,15(31),16,18(30),21,25(29),26-undecaene-3-carbaldehyde.
| Compound Name | (3S,21Z)-5-oxo-19,24-dioxa-4,10,12,31-tetrazapentacyclo[23.2.2.112,15.114,18.06,11]hentriaconta-1(28),6(11),7,9,13,15(31),16,18(30),21,25(29),26-undecaene-3-carbaldehyde |
|---|---|
| PubChem CID | 155409242 |
| Molecular Formula | C26H22N4O4 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | (3S,21Z)-5-oxo-19,24-dioxa-4,10,12,31-tetrazapentacyclo[23.2.2.112,15.114,18.06,11]hentriaconta-1(28),6(11),7,9,13,15(31),16,18(30),21,25(29),26-undecaene-3-carbaldehyde |
| SMILES | O=C[C@@H]1Cc2ccc(cc2)OC/C=C\COc2ccc3nn(cc3c2)-c2ncccc2C(=O)N1 |
| InChI | InChI=1S/C26H22N4O4/c31-17-20-14-18-5-7-21(8-6-18)33-12-1-2-13-34-22-9-10-24-19(15-22)16-30(29-24)25-23(26(32)28-20)4-3-11-27-25/h1-11,15-17,20H,12-14H2,(H,28,32)/b2-1-/t20-/m0/s1 |
| InChIKey | JMYRNXQXGJJZPX-SZSMBMMGSA-N |
| XLogP | 3.29 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|