C29H29N5O5 — CID 155409366
N-ethyl-2-oxo-2-[(3S)-5-oxo-20,25-dioxa-4,10,12,13-tetrazapentacyclo[24.2.2.115,19.06,11.012,16]hentriaconta-1(29),6(11),7,9,13,15,17,19(31),26(30),27-decaen-3-yl]acetamide (PubChem CID 155409366) has the molecular formula C29H29N5O5 and a molecular weight of 527.58 g/mol. Its IUPAC name is N-ethyl-2-oxo-2-[(3S)-5-oxo-20,25-dioxa-4,10,12,13-tetrazapentacyclo[24.2.2.115,19.06,11.012,16]hentriaconta-1(29),6(11),7,9,13,15,17,19(31),26(30),27-decaen-3-yl]acetamide.
| Compound Name | N-ethyl-2-oxo-2-[(3S)-5-oxo-20,25-dioxa-4,10,12,13-tetrazapentacyclo[24.2.2.115,19.06,11.012,16]hentriaconta-1(29),6(11),7,9,13,15,17,19(31),26(30),27-decaen-3-yl]acetamide |
|---|---|
| PubChem CID | 155409366 |
| Molecular Formula | C29H29N5O5 |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | N-ethyl-2-oxo-2-[(3S)-5-oxo-20,25-dioxa-4,10,12,13-tetrazapentacyclo[24.2.2.115,19.06,11.012,16]hentriaconta-1(29),6(11),7,9,13,15,17,19(31),26(30),27-decaen-3-yl]acetamide |
| SMILES | CCNC(=O)C(=O)[C@@H]1Cc2ccc(cc2)OCCCCOc2ccc3c(cnn3-c3ncccc3C(=O)N1)c2 |
| InChI | InChI=1S/C29H29N5O5/c1-2-30-29(37)26(35)24-16-19-7-9-21(10-8-19)38-14-3-4-15-39-22-11-12-25-20(17-22)18-32-34(25)27-23(28(36)33-24)6-5-13-31-27/h5-13,17-18,24H,2-4,14-16H2,1H3,(H,30,37)(H,33,36)/t24-/m0/s1 |
| InChIKey | NKRBHVMLIDAHFB-DEOSSOPVSA-N |
| XLogP | 3.02 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|