C13H28N2O — CID 155409413
(3S)-3,7-bis(propan-2-ylamino)heptan-2-one (PubChem CID 155409413) has the molecular formula C13H28N2O and a molecular weight of 228.38 g/mol. Its IUPAC name is (3S)-3,7-bis(propan-2-ylamino)heptan-2-one.
| Compound Name | (3S)-3,7-bis(propan-2-ylamino)heptan-2-one |
|---|---|
| PubChem CID | 155409413 |
| Molecular Formula | C13H28N2O |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.22 |
| IUPAC Name | (3S)-3,7-bis(propan-2-ylamino)heptan-2-one |
| SMILES | CC(=O)[C@H](CCCCNC(C)C)NC(C)C |
| InChI | InChI=1S/C13H28N2O/c1-10(2)14-9-7-6-8-13(12(5)16)15-11(3)4/h10-11,13-15H,6-9H2,1-5H3/t13-/m0/s1 |
| InChIKey | FGHCLNKYQNBRSZ-ZDUSSCGKSA-N |
| XLogP | 2.11 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|