C18H17N3O3 — CID 155409419
(10S,12E)-8-oxo-16-oxa-9,20,21-triazatricyclo[15.3.1.02,7]henicosa-1(20),2,4,6,12,17(21),18-heptaene-10-carbaldehyde (PubChem CID 155409419) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is (10S,12E)-8-oxo-16-oxa-9,20,21-triazatricyclo[15.3.1.02,7]henicosa-1(20),2,4,6,12,17(21),18-heptaene-10-carbaldehyde.
| Compound Name | (10S,12E)-8-oxo-16-oxa-9,20,21-triazatricyclo[15.3.1.02,7]henicosa-1(20),2,4,6,12,17(21),18-heptaene-10-carbaldehyde |
|---|---|
| PubChem CID | 155409419 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | (10S,12E)-8-oxo-16-oxa-9,20,21-triazatricyclo[15.3.1.02,7]henicosa-1(20),2,4,6,12,17(21),18-heptaene-10-carbaldehyde |
| SMILES | O=C[C@@H]1C/C=C/CCOc2ccnc(n2)-c2ccccc2C(=O)N1 |
| InChI | InChI=1S/C18H17N3O3/c22-12-13-6-2-1-5-11-24-16-9-10-19-17(21-16)14-7-3-4-8-15(14)18(23)20-13/h1-4,7-10,12-13H,5-6,11H2,(H,20,23)/b2-1+/t13-/m0/s1 |
| InChIKey | CBVUVSFNPJCECJ-AORQRIRUSA-N |
| XLogP | 2.17 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|