C26H32ClFN4O3 — CID 155409570
(3R,4R)-5-(4-chlorophenyl)-4-[2-[4-[(4-fluorophenyl)methylamino]butyl]pyrazol-3-yl]-N-hydroxy-3-methoxypentanamide (PubChem CID 155409570) has the molecular formula C26H32ClFN4O3 and a molecular weight of 503.02 g/mol. Its IUPAC name is (3R,4R)-5-(4-chlorophenyl)-4-[2-[4-[(4-fluorophenyl)methylamino]butyl]pyrazol-3-yl]-N-hydroxy-3-methoxypentanamide.
| Compound Name | (3R,4R)-5-(4-chlorophenyl)-4-[2-[4-[(4-fluorophenyl)methylamino]butyl]pyrazol-3-yl]-N-hydroxy-3-methoxypentanamide |
|---|---|
| PubChem CID | 155409570 |
| Molecular Formula | C26H32ClFN4O3 |
| Molecular Weight | 503.02 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | (3R,4R)-5-(4-chlorophenyl)-4-[2-[4-[(4-fluorophenyl)methylamino]butyl]pyrazol-3-yl]-N-hydroxy-3-methoxypentanamide |
| SMILES | CO[C@H](CC(=O)NO)[C@H](Cc1ccc(Cl)cc1)c1ccnn1CCCCNCc1ccc(F)cc1 |
| InChI | InChI=1S/C26H32ClFN4O3/c1-35-25(17-26(33)31-34)23(16-19-4-8-21(27)9-5-19)24-12-14-30-32(24)15-3-2-13-29-18-20-6-10-22(28)11-7-20/h4-12,14,23,25,29,34H,2-3,13,15-18H2,1H3,(H,31,33)/t23-,25-/m1/s1 |
| InChIKey | AWQYRBZYAKNXIT-ILBGXUMGSA-N |
| XLogP | 4.48 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.02 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|