C24H25ClF3N3O5 — CID 155409625
4-(1-benzylpyrazol-3-yl)-5-(4-chlorophenyl)-N-hydroxy-3-methoxypentanamide;2,2,2-trifluoroacetic acid (PubChem CID 155409625) has the molecular formula C24H25ClF3N3O5 and a molecular weight of 527.93 g/mol. Its IUPAC name is 4-(1-benzylpyrazol-3-yl)-5-(4-chlorophenyl)-N-hydroxy-3-methoxypentanamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-(1-benzylpyrazol-3-yl)-5-(4-chlorophenyl)-N-hydroxy-3-methoxypentanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155409625 |
| Molecular Formula | C24H25ClF3N3O5 |
| Molecular Weight | 527.93 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | 4-(1-benzylpyrazol-3-yl)-5-(4-chlorophenyl)-N-hydroxy-3-methoxypentanamide;2,2,2-trifluoroacetic acid |
| SMILES | COC(CC(=O)NO)C(Cc1ccc(Cl)cc1)c1ccn(Cc2ccccc2)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H24ClN3O3.C2HF3O2/c1-29-21(14-22(27)25-28)19(13-16-7-9-18(23)10-8-16)20-11-12-26(24-20)15-17-5-3-2-4-6-17;3-2(4,5)1(6)7/h2-12,19,21,28H,13-15H2,1H3,(H,25,27);(H,6,7) |
| InChIKey | SXJYBQUDJDXVFY-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.93 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|