C23H34N3O3S- — CID 155409697
1-[1-(cyclopropylmethyl)-8-(dimethylamino)-2-oxo-8-phenyl-1,3-diazaspiro[4.5]decan-3-yl]propane-2-sulfinate (PubChem CID 155409697) has the molecular formula C23H34N3O3S- and a molecular weight of 432.61 g/mol. Its IUPAC name is 1-[1-(cyclopropylmethyl)-8-(dimethylamino)-2-oxo-8-phenyl-1,3-diazaspiro[4.5]decan-3-yl]propane-2-sulfinate.
| Compound Name | 1-[1-(cyclopropylmethyl)-8-(dimethylamino)-2-oxo-8-phenyl-1,3-diazaspiro[4.5]decan-3-yl]propane-2-sulfinate |
|---|---|
| PubChem CID | 155409697 |
| Molecular Formula | C23H34N3O3S- |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 1-[1-(cyclopropylmethyl)-8-(dimethylamino)-2-oxo-8-phenyl-1,3-diazaspiro[4.5]decan-3-yl]propane-2-sulfinate |
| SMILES | CC(CN1CC2(CCC(c3ccccc3)(N(C)C)CC2)N(CC2CC2)C1=O)S(=O)[O-] |
| InChI | InChI=1S/C23H35N3O3S/c1-18(30(28)29)15-25-17-22(26(21(25)27)16-19-9-10-19)11-13-23(14-12-22,24(2)3)20-7-5-4-6-8-20/h4-8,18-19H,9-17H2,1-3H3,(H,28,29)/p-1 |
| InChIKey | TZZDKOGNLUHKIP-UHFFFAOYSA-M |
| XLogP | 3.17 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|