C57H37N5O — CID 155410982
N-dibenzofuran-3-yl-9-(4,6-diphenyl-1,3,5-triazin-2-yl)-7-phenyl-N-(4-phenylphenyl)carbazol-2-amine (PubChem CID 155410982) has the molecular formula C57H37N5O and a molecular weight of 807.96 g/mol. Its IUPAC name is N-dibenzofuran-3-yl-9-(4,6-diphenyl-1,3,5-triazin-2-yl)-7-phenyl-N-(4-phenylphenyl)carbazol-2-amine.
| Compound Name | N-dibenzofuran-3-yl-9-(4,6-diphenyl-1,3,5-triazin-2-yl)-7-phenyl-N-(4-phenylphenyl)carbazol-2-amine |
|---|---|
| PubChem CID | 155410982 |
| Molecular Formula | C57H37N5O |
| Molecular Weight | 807.96 g/mol |
| Exact Mass | 807.30 |
| IUPAC Name | N-dibenzofuran-3-yl-9-(4,6-diphenyl-1,3,5-triazin-2-yl)-7-phenyl-N-(4-phenylphenyl)carbazol-2-amine |
| SMILES | c1ccc(-c2ccc(N(c3ccc4c(c3)oc3ccccc34)c3ccc4c5ccc(-c6ccccc6)cc5n(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c4c3)cc2)cc1 |
| InChI | InChI=1S/C57H37N5O/c1-5-15-38(16-6-1)40-25-28-44(29-26-40)61(46-31-34-50-49-23-13-14-24-53(49)63-54(50)37-46)45-30-33-48-47-32-27-43(39-17-7-2-8-18-39)35-51(47)62(52(48)36-45)57-59-55(41-19-9-3-10-20-41)58-56(60-57)42-21-11-4-12-22-42/h1-37H |
| InChIKey | VCIRBQOJYZLPAV-UHFFFAOYSA-N |
| XLogP | 15.01 |
| TPSA | 59.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.96 |
| LogP ≤ 5 | 15.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |