C10H11F3O2 — CID 15541137
2,6-dimethyl-4-(2,2,2-trifluoroethoxy)phenol (PubChem CID 15541137) has the molecular formula C10H11F3O2 and a molecular weight of 220.19 g/mol. Its IUPAC name is 2,6-dimethyl-4-(2,2,2-trifluoroethoxy)phenol.
| Compound Name | 2,6-dimethyl-4-(2,2,2-trifluoroethoxy)phenol |
|---|---|
| PubChem CID | 15541137 |
| Molecular Formula | C10H11F3O2 |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 2,6-dimethyl-4-(2,2,2-trifluoroethoxy)phenol |
| SMILES | Cc1cc(OCC(F)(F)F)cc(C)c1O |
| InChI | InChI=1S/C10H11F3O2/c1-6-3-8(4-7(2)9(6)14)15-5-10(11,12)13/h3-4,14H,5H2,1-2H3 |
| InChIKey | BBKKBBXSPWMLKL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |