About N-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-1H-pyrrolo[2,3-b]pyridin-6-amine
N-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-1H-pyrrolo[2,3-b]pyridin-6-amine (PubChem CID 155412163) has the molecular formula C15H14N4
and a molecular weight of 250.31 g/mol. Its IUPAC name is N-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-1H-pyrrolo[2,3-b]pyridin-6-amine.
Molecular Properties
| Compound Name | N-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-1H-pyrrolo[2,3-b]pyridin-6-amine |
| PubChem CID | 155412163 |
| Molecular Formula | C15H14N4 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | N-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-1H-pyrrolo[2,3-b]pyridin-6-amine |
| SMILES | c1cc2ccc(Nc3ccc4c(n3)CCC4)nc2[nH]1 |
| InChI | InChI=1S/C15H14N4/c1-2-10-4-6-13(17-12(10)3-1)18-14-7-5-11-8-9-16-15(11)19-14/h4-9H,1-3H2,(H2,16,17,18,19) |
| InChIKey | SETXIQIEAJIGEH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-1H-pyrrolo[2,3-b]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-1H-pyrrolo[2,3-b]pyridin-6-amine?
The IUPAC name of N-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-1H-pyrrolo[2,3-b]pyridin-6-amine (CID 155412163) is N-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-1H-pyrrolo[2,3-b]pyridin-6-amine.
What is the SMILES notation for N-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-1H-pyrrolo[2,3-b]pyridin-6-amine?
The canonical SMILES for N-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-1H-pyrrolo[2,3-b]pyridin-6-amine is c1cc2ccc(Nc3ccc4c(n3)CCC4)nc2[nH]1.
What is the InChIKey of N-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-1H-pyrrolo[2,3-b]pyridin-6-amine?
The InChIKey is SETXIQIEAJIGEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N4/c1-2-10-4-6-13(17-12(10)3-1)18-14-7-5-11-8-9-16-15(11)19-14/h4-9H,1-3H2,(H2,16,17,18,19).
What are the key properties of N-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-1H-pyrrolo[2,3-b]pyridin-6-amine?
N-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-1H-pyrrolo[2,3-b]pyridin-6-amine has a molecular weight of 250.31 g/mol, XLogP of 3.19, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-1H-pyrrolo[2,3-b]pyridin-6-amine is sourced from PubChem (CID 155412163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).