C18H16F3N3O2 — CID 155412410
1-(1H-indol-6-yl)-3-[2-[2-(trifluoromethyl)phenoxy]ethyl]urea (PubChem CID 155412410) has the molecular formula C18H16F3N3O2 and a molecular weight of 363.34 g/mol. Its IUPAC name is 1-(1H-indol-6-yl)-3-[2-[2-(trifluoromethyl)phenoxy]ethyl]urea.
| Compound Name | 1-(1H-indol-6-yl)-3-[2-[2-(trifluoromethyl)phenoxy]ethyl]urea |
|---|---|
| PubChem CID | 155412410 |
| Molecular Formula | C18H16F3N3O2 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 1-(1H-indol-6-yl)-3-[2-[2-(trifluoromethyl)phenoxy]ethyl]urea |
| SMILES | O=C(NCCOc1ccccc1C(F)(F)F)Nc1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C18H16F3N3O2/c19-18(20,21)14-3-1-2-4-16(14)26-10-9-23-17(25)24-13-6-5-12-7-8-22-15(12)11-13/h1-8,11,22H,9-10H2,(H2,23,24,25) |
| InChIKey | CETOOMNBUJYFPO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|