C18H17ClN4O — CID 155412419
1-(4-chloro-1H-indol-6-yl)-3-(5,6,7,8-tetrahydroisoquinolin-5-yl)urea (PubChem CID 155412419) has the molecular formula C18H17ClN4O and a molecular weight of 340.81 g/mol. Its IUPAC name is 1-(4-chloro-1H-indol-6-yl)-3-(5,6,7,8-tetrahydroisoquinolin-5-yl)urea.
| Compound Name | 1-(4-chloro-1H-indol-6-yl)-3-(5,6,7,8-tetrahydroisoquinolin-5-yl)urea |
|---|---|
| PubChem CID | 155412419 |
| Molecular Formula | C18H17ClN4O |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 1-(4-chloro-1H-indol-6-yl)-3-(5,6,7,8-tetrahydroisoquinolin-5-yl)urea |
| SMILES | O=C(Nc1cc(Cl)c2cc[nH]c2c1)NC1CCCc2cnccc21 |
| InChI | InChI=1S/C18H17ClN4O/c19-15-8-12(9-17-14(15)5-7-21-17)22-18(24)23-16-3-1-2-11-10-20-6-4-13(11)16/h4-10,16,21H,1-3H2,(H2,22,23,24) |
| InChIKey | OKWOQQQXEQDCTB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |