About 8-benzhydryl-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one
8-benzhydryl-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 15541261) has the molecular formula C26H27N3O
and a molecular weight of 397.52 g/mol. Its IUPAC name is 8-benzhydryl-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one.
Molecular Properties
| Compound Name | 8-benzhydryl-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
| PubChem CID | 15541261 |
| Molecular Formula | C26H27N3O |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 8-benzhydryl-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | O=C1NCN(c2ccccc2)C12CCN(C(c1ccccc1)c1ccccc1)CC2 |
| InChI | InChI=1S/C26H27N3O/c30-25-26(29(20-27-25)23-14-8-3-9-15-23)16-18-28(19-17-26)24(21-10-4-1-5-11-21)22-12-6-2-7-13-22/h1-15,24H,16-20H2,(H,27,30) |
| InChIKey | MLVHNSLPGKIYBU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-benzhydryl-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-benzhydryl-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one?
The IUPAC name of 8-benzhydryl-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one (CID 15541261) is 8-benzhydryl-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one.
What is the SMILES notation for 8-benzhydryl-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one?
The canonical SMILES for 8-benzhydryl-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one is O=C1NCN(c2ccccc2)C12CCN(C(c1ccccc1)c1ccccc1)CC2.
What is the InChIKey of 8-benzhydryl-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one?
The InChIKey is MLVHNSLPGKIYBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H27N3O/c30-25-26(29(20-27-25)23-14-8-3-9-15-23)16-18-28(19-17-26)24(21-10-4-1-5-11-21)22-12-6-2-7-13-22/h1-15,24H,16-20H2,(H,27,30).
What are the key properties of 8-benzhydryl-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one?
8-benzhydryl-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one has a molecular weight of 397.52 g/mol, XLogP of 4.20, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-benzhydryl-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one is sourced from PubChem (CID 15541261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).