C36H37F4N5O2 — CID 155412653
(E)-N-cyclopentyl-4-[(3R)-3-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-enamide (PubChem CID 155412653) has the molecular formula C36H37F4N5O2 and a molecular weight of 647.72 g/mol. Its IUPAC name is (E)-N-cyclopentyl-4-[(3R)-3-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-enamide.
| Compound Name | (E)-N-cyclopentyl-4-[(3R)-3-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-enamide |
|---|---|
| PubChem CID | 155412653 |
| Molecular Formula | C36H37F4N5O2 |
| Molecular Weight | 647.72 g/mol |
| Exact Mass | 647.29 |
| IUPAC Name | (E)-N-cyclopentyl-4-[(3R)-3-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]piperidin-1-yl]but-2-enamide |
| SMILES | O=C(/C=C/CN1CCC[C@@H](Oc2ccc(/C(=C(/CC(F)(F)F)c3ccccc3)c3ccc4n[nH]c(F)c4c3)cn2)C1)NC1CCCC1 |
| InChI | InChI=1S/C36H37F4N5O2/c37-35-29-20-25(14-16-31(29)43-44-35)34(30(21-36(38,39)40)24-8-2-1-3-9-24)26-15-17-33(41-22-26)47-28-12-6-18-45(23-28)19-7-13-32(46)42-27-10-4-5-11-27/h1-3,7-9,13-17,20,22,27-28H,4-6,10-12,18-19,21,23H2,(H,42,46)(H,43,44)/b13-7+,34-30-/t28-/m1/s1 |
| InChIKey | ISUROGQNTPZBRW-LXVKPJTASA-N |
| XLogP | 7.47 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.72 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|