C32H37F2N5O2 — CID 155412765
ethyl (2R)-2-[6-[4-[(3R,4R)-1-ethyl-3-fluoropiperidin-4-yl]phenyl]-4,7-dimethylindazol-2-yl]-2-[(6R)-6-fluoro-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl]acetate (PubChem CID 155412765) has the molecular formula C32H37F2N5O2 and a molecular weight of 561.68 g/mol. Its IUPAC name is ethyl (2R)-2-[6-[4-[(3R,4R)-1-ethyl-3-fluoropiperidin-4-yl]phenyl]-4,7-dimethylindazol-2-yl]-2-[(6R)-6-fluoro-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl]acetate.
| Compound Name | ethyl (2R)-2-[6-[4-[(3R,4R)-1-ethyl-3-fluoropiperidin-4-yl]phenyl]-4,7-dimethylindazol-2-yl]-2-[(6R)-6-fluoro-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl]acetate |
|---|---|
| PubChem CID | 155412765 |
| Molecular Formula | C32H37F2N5O2 |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.29 |
| IUPAC Name | ethyl (2R)-2-[6-[4-[(3R,4R)-1-ethyl-3-fluoropiperidin-4-yl]phenyl]-4,7-dimethylindazol-2-yl]-2-[(6R)-6-fluoro-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl]acetate |
| SMILES | CCOC(=O)[C@@H](c1ncn2c1C[C@@H](F)C2)n1cc2c(C)cc(-c3ccc([C@H]4CCN(CC)C[C@@H]4F)cc3)c(C)c2n1 |
| InChI | InChI=1S/C32H37F2N5O2/c1-5-37-12-11-24(27(34)17-37)21-7-9-22(10-8-21)25-13-19(3)26-16-39(36-29(26)20(25)4)31(32(40)41-6-2)30-28-14-23(33)15-38(28)18-35-30/h7-10,13,16,18,23-24,27,31H,5-6,11-12,14-15,17H2,1-4H3/t23-,24-,27+,31-/m1/s1 |
| InChIKey | YXBNYUOVFMSOIT-GTHNRUEPSA-N |
| XLogP | 5.71 |
| TPSA | 65.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |