About 3-[4-[(4-methylpyrimidin-2-yl)amino]phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol
3-[4-[(4-methylpyrimidin-2-yl)amino]phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol (PubChem CID 155413288) has the molecular formula C15H13F3N4O2
and a molecular weight of 338.29 g/mol. Its IUPAC name is 3-[4-[(4-methylpyrimidin-2-yl)amino]phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol.
Molecular Properties
| Compound Name | 3-[4-[(4-methylpyrimidin-2-yl)amino]phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol |
| PubChem CID | 155413288 |
| Molecular Formula | C15H13F3N4O2 |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 3-[4-[(4-methylpyrimidin-2-yl)amino]phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol |
| SMILES | Cc1ccnc(Nc2ccc(C3=NOC(O)(C(F)(F)F)C3)cc2)n1 |
| InChI | InChI=1S/C15H13F3N4O2/c1-9-6-7-19-13(20-9)21-11-4-2-10(3-5-11)12-8-14(23,24-22-12)15(16,17)18/h2-7,23H,8H2,1H3,(H,19,20,21) |
| InChIKey | AYPYHCMDYFQYRS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[4-[(4-methylpyrimidin-2-yl)amino]phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(4-methylpyrimidin-2-yl)amino]phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol?
The IUPAC name of 3-[4-[(4-methylpyrimidin-2-yl)amino]phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol (CID 155413288) is 3-[4-[(4-methylpyrimidin-2-yl)amino]phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol.
What is the SMILES notation for 3-[4-[(4-methylpyrimidin-2-yl)amino]phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol?
The canonical SMILES for 3-[4-[(4-methylpyrimidin-2-yl)amino]phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol is Cc1ccnc(Nc2ccc(C3=NOC(O)(C(F)(F)F)C3)cc2)n1.
What is the InChIKey of 3-[4-[(4-methylpyrimidin-2-yl)amino]phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol?
The InChIKey is AYPYHCMDYFQYRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F3N4O2/c1-9-6-7-19-13(20-9)21-11-4-2-10(3-5-11)12-8-14(23,24-22-12)15(16,17)18/h2-7,23H,8H2,1H3,(H,19,20,21).
What are the key properties of 3-[4-[(4-methylpyrimidin-2-yl)amino]phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol?
3-[4-[(4-methylpyrimidin-2-yl)amino]phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol has a molecular weight of 338.29 g/mol, XLogP of 2.90, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(4-methylpyrimidin-2-yl)amino]phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol is sourced from PubChem (CID 155413288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).