About 3-[4-(benzenesulfonyl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol
3-[4-(benzenesulfonyl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol (PubChem CID 155413419) has the molecular formula C16H12F3NO4S
and a molecular weight of 371.34 g/mol. Its IUPAC name is 3-[4-(benzenesulfonyl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol.
Molecular Properties
| Compound Name | 3-[4-(benzenesulfonyl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol |
| PubChem CID | 155413419 |
| Molecular Formula | C16H12F3NO4S |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 3-[4-(benzenesulfonyl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol |
| SMILES | O=S(=O)(c1ccccc1)c1ccc(C2=NOC(O)(C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C16H12F3NO4S/c17-16(18,19)15(21)10-14(20-24-15)11-6-8-13(9-7-11)25(22,23)12-4-2-1-3-5-12/h1-9,21H,10H2 |
| InChIKey | LOFXTNZLVKWDKJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[4-(benzenesulfonyl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(benzenesulfonyl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol?
The IUPAC name of 3-[4-(benzenesulfonyl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol (CID 155413419) is 3-[4-(benzenesulfonyl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol.
What is the SMILES notation for 3-[4-(benzenesulfonyl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol?
The canonical SMILES for 3-[4-(benzenesulfonyl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol is O=S(=O)(c1ccccc1)c1ccc(C2=NOC(O)(C(F)(F)F)C2)cc1.
What is the InChIKey of 3-[4-(benzenesulfonyl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol?
The InChIKey is LOFXTNZLVKWDKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12F3NO4S/c17-16(18,19)15(21)10-14(20-24-15)11-6-8-13(9-7-11)25(22,23)12-4-2-1-3-5-12/h1-9,21H,10H2.
What are the key properties of 3-[4-(benzenesulfonyl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol?
3-[4-(benzenesulfonyl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol has a molecular weight of 371.34 g/mol, XLogP of 2.89, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(benzenesulfonyl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol is sourced from PubChem (CID 155413419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).