C22H26N8 — CID 155414227
6-N-(2-amino-2-phenylethyl)-4-N-[4-(dimethylamino)phenyl]-1-methylpyrazolo[3,4-d]pyrimidine-4,6-diamine (PubChem CID 155414227) has the molecular formula C22H26N8 and a molecular weight of 402.51 g/mol. Its IUPAC name is 6-N-(2-amino-2-phenylethyl)-4-N-[4-(dimethylamino)phenyl]-1-methylpyrazolo[3,4-d]pyrimidine-4,6-diamine.
| Compound Name | 6-N-(2-amino-2-phenylethyl)-4-N-[4-(dimethylamino)phenyl]-1-methylpyrazolo[3,4-d]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 155414227 |
| Molecular Formula | C22H26N8 |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 6-N-(2-amino-2-phenylethyl)-4-N-[4-(dimethylamino)phenyl]-1-methylpyrazolo[3,4-d]pyrimidine-4,6-diamine |
| SMILES | CN(C)c1ccc(Nc2nc(NCC(N)c3ccccc3)nc3c2cnn3C)cc1 |
| InChI | InChI=1S/C22H26N8/c1-29(2)17-11-9-16(10-12-17)26-20-18-13-25-30(3)21(18)28-22(27-20)24-14-19(23)15-7-5-4-6-8-15/h4-13,19H,14,23H2,1-3H3,(H2,24,26,27,28) |
| InChIKey | HPBZJLKCTZUYKS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 96.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|