C16H19BrFNO5 — CID 155414378
2-[4-bromo-2-(4-butoxy-4,5-dihydro-1,2-oxazol-3-yl)-5-fluorophenoxy]propanoic acid (PubChem CID 155414378) has the molecular formula C16H19BrFNO5 and a molecular weight of 404.23 g/mol. Its IUPAC name is 2-[4-bromo-2-(4-butoxy-4,5-dihydro-1,2-oxazol-3-yl)-5-fluorophenoxy]propanoic acid.
| Compound Name | 2-[4-bromo-2-(4-butoxy-4,5-dihydro-1,2-oxazol-3-yl)-5-fluorophenoxy]propanoic acid |
|---|---|
| PubChem CID | 155414378 |
| Molecular Formula | C16H19BrFNO5 |
| Molecular Weight | 404.23 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | 2-[4-bromo-2-(4-butoxy-4,5-dihydro-1,2-oxazol-3-yl)-5-fluorophenoxy]propanoic acid |
| SMILES | CCCCOC1CON=C1c1cc(Br)c(F)cc1OC(C)C(=O)O |
| InChI | InChI=1S/C16H19BrFNO5/c1-3-4-5-22-14-8-23-19-15(14)10-6-11(17)12(18)7-13(10)24-9(2)16(20)21/h6-7,9,14H,3-5,8H2,1-2H3,(H,20,21) |
| InChIKey | QUPGBDJNJDLWJX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.23 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|