C30H28Cl2FN7O4S — CID 155414404
2-[4-[4,7-dichloro-2-[1-[(6R)-6-fluoro-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl]-2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]indazol-6-yl]phenyl]ethyl N-(2-methoxyethyl)carbamate (PubChem CID 155414404) has the molecular formula C30H28Cl2FN7O4S and a molecular weight of 672.57 g/mol. Its IUPAC name is 2-[4-[4,7-dichloro-2-[1-[(6R)-6-fluoro-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl]-2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]indazol-6-yl]phenyl]ethyl N-(2-methoxyethyl)carbamate.
| Compound Name | 2-[4-[4,7-dichloro-2-[1-[(6R)-6-fluoro-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl]-2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]indazol-6-yl]phenyl]ethyl N-(2-methoxyethyl)carbamate |
|---|---|
| PubChem CID | 155414404 |
| Molecular Formula | C30H28Cl2FN7O4S |
| Molecular Weight | 672.57 g/mol |
| Exact Mass | 671.13 |
| IUPAC Name | 2-[4-[4,7-dichloro-2-[1-[(6R)-6-fluoro-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl]-2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]indazol-6-yl]phenyl]ethyl N-(2-methoxyethyl)carbamate |
| SMILES | COCCNC(=O)OCCc1ccc(-c2cc(Cl)c3cn(C(C(=O)Nc4nccs4)c4ncn5c4C[C@@H](F)C5)nc3c2Cl)cc1 |
| InChI | InChI=1S/C30H28Cl2FN7O4S/c1-43-10-7-35-30(42)44-9-6-17-2-4-18(5-3-17)20-13-22(31)21-15-40(38-25(21)24(20)32)27(28(41)37-29-34-8-11-45-29)26-23-12-19(33)14-39(23)16-36-26/h2-5,8,11,13,15-16,19,27H,6-7,9-10,12,14H2,1H3,(H,35,42)(H,34,37,41)/t19-,27?/m1/s1 |
| InChIKey | UPSLWXDNWMSECJ-FOEZPWHWSA-N |
| XLogP | 5.70 |
| TPSA | 125.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.57 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|