About 2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-8-(3-methylbutyl)chromen-4-one
2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-8-(3-methylbutyl)chromen-4-one (PubChem CID 15541483) has the molecular formula C20H20O6
and a molecular weight of 356.37 g/mol. Its IUPAC name is 2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-8-(3-methylbutyl)chromen-4-one.
Molecular Properties
| Compound Name | 2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-8-(3-methylbutyl)chromen-4-one |
| PubChem CID | 15541483 |
| Molecular Formula | C20H20O6 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-8-(3-methylbutyl)chromen-4-one |
| SMILES | CC(C)CCc1c(O)cc(O)c2c(=O)cc(-c3ccc(O)cc3O)oc12 |
| InChI | InChI=1S/C20H20O6/c1-10(2)3-5-13-15(23)8-16(24)19-17(25)9-18(26-20(13)19)12-6-4-11(21)7-14(12)22/h4,6-10,21-24H,3,5H2,1-2H3 |
| InChIKey | WBUGKOXHVKDEKK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-8-(3-methylbutyl)chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-8-(3-methylbutyl)chromen-4-one?
The IUPAC name of 2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-8-(3-methylbutyl)chromen-4-one (CID 15541483) is 2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-8-(3-methylbutyl)chromen-4-one.
What is the SMILES notation for 2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-8-(3-methylbutyl)chromen-4-one?
The canonical SMILES for 2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-8-(3-methylbutyl)chromen-4-one is CC(C)CCc1c(O)cc(O)c2c(=O)cc(-c3ccc(O)cc3O)oc12.
What is the InChIKey of 2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-8-(3-methylbutyl)chromen-4-one?
The InChIKey is WBUGKOXHVKDEKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20O6/c1-10(2)3-5-13-15(23)8-16(24)19-17(25)9-18(26-20(13)19)12-6-4-11(21)7-14(12)22/h4,6-10,21-24H,3,5H2,1-2H3.
What are the key properties of 2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-8-(3-methylbutyl)chromen-4-one?
2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-8-(3-methylbutyl)chromen-4-one has a molecular weight of 356.37 g/mol, XLogP of 3.87, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-8-(3-methylbutyl)chromen-4-one is sourced from PubChem (CID 15541483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).