About [1-(4-bromo-2,3-difluorophenyl)-2-oxopiperidin-3-yl]carbamic acid
[1-(4-bromo-2,3-difluorophenyl)-2-oxopiperidin-3-yl]carbamic acid (PubChem CID 155415178) has the molecular formula C12H11BrF2N2O3
and a molecular weight of 349.13 g/mol. Its IUPAC name is [1-(4-bromo-2,3-difluorophenyl)-2-oxopiperidin-3-yl]carbamic acid.
Molecular Properties
| Compound Name | [1-(4-bromo-2,3-difluorophenyl)-2-oxopiperidin-3-yl]carbamic acid |
| PubChem CID | 155415178 |
| Molecular Formula | C12H11BrF2N2O3 |
| Molecular Weight | 349.13 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | [1-(4-bromo-2,3-difluorophenyl)-2-oxopiperidin-3-yl]carbamic acid |
| SMILES | O=C(O)NC1CCCN(c2ccc(Br)c(F)c2F)C1=O |
| InChI | InChI=1S/C12H11BrF2N2O3/c13-6-3-4-8(10(15)9(6)14)17-5-1-2-7(11(17)18)16-12(19)20/h3-4,7,16H,1-2,5H2,(H,19,20) |
| InChIKey | GQPQYDOLNRBQFE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.13 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze [1-(4-bromo-2,3-difluorophenyl)-2-oxopiperidin-3-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-bromo-2,3-difluorophenyl)-2-oxopiperidin-3-yl]carbamic acid?
The IUPAC name of [1-(4-bromo-2,3-difluorophenyl)-2-oxopiperidin-3-yl]carbamic acid (CID 155415178) is [1-(4-bromo-2,3-difluorophenyl)-2-oxopiperidin-3-yl]carbamic acid.
What is the SMILES notation for [1-(4-bromo-2,3-difluorophenyl)-2-oxopiperidin-3-yl]carbamic acid?
The canonical SMILES for [1-(4-bromo-2,3-difluorophenyl)-2-oxopiperidin-3-yl]carbamic acid is O=C(O)NC1CCCN(c2ccc(Br)c(F)c2F)C1=O.
What is the InChIKey of [1-(4-bromo-2,3-difluorophenyl)-2-oxopiperidin-3-yl]carbamic acid?
The InChIKey is GQPQYDOLNRBQFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11BrF2N2O3/c13-6-3-4-8(10(15)9(6)14)17-5-1-2-7(11(17)18)16-12(19)20/h3-4,7,16H,1-2,5H2,(H,19,20).
What are the key properties of [1-(4-bromo-2,3-difluorophenyl)-2-oxopiperidin-3-yl]carbamic acid?
[1-(4-bromo-2,3-difluorophenyl)-2-oxopiperidin-3-yl]carbamic acid has a molecular weight of 349.13 g/mol, XLogP of 2.49, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-bromo-2,3-difluorophenyl)-2-oxopiperidin-3-yl]carbamic acid is sourced from PubChem (CID 155415178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).