C26H25F2N5O5 — CID 155415351
N-[5-[2-(2,6-difluoro-3,5-dimethoxyphenyl)ethynyl]pyrimidin-2-yl]-7-(dimethoxymethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide (PubChem CID 155415351) has the molecular formula C26H25F2N5O5 and a molecular weight of 525.51 g/mol. Its IUPAC name is N-[5-[2-(2,6-difluoro-3,5-dimethoxyphenyl)ethynyl]pyrimidin-2-yl]-7-(dimethoxymethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide.
| Compound Name | N-[5-[2-(2,6-difluoro-3,5-dimethoxyphenyl)ethynyl]pyrimidin-2-yl]-7-(dimethoxymethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
|---|---|
| PubChem CID | 155415351 |
| Molecular Formula | C26H25F2N5O5 |
| Molecular Weight | 525.51 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | N-[5-[2-(2,6-difluoro-3,5-dimethoxyphenyl)ethynyl]pyrimidin-2-yl]-7-(dimethoxymethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
| SMILES | COc1cc(OC)c(F)c(C#Cc2cnc(NC(=O)N3CCCc4ccc(C(OC)OC)nc43)nc2)c1F |
| InChI | InChI=1S/C26H25F2N5O5/c1-35-19-12-20(36-2)22(28)17(21(19)27)9-7-15-13-29-25(30-14-15)32-26(34)33-11-5-6-16-8-10-18(31-23(16)33)24(37-3)38-4/h8,10,12-14,24H,5-6,11H2,1-4H3,(H,29,30,32,34) |
| InChIKey | FWNHKZAFUKSQOH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 107.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|