C23H35NO4 — CID 15541547
[(3S,5S,8R,9S,10S,13S,14S,16S)-16-acetamido-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 15541547) has the molecular formula C23H35NO4 and a molecular weight of 389.54 g/mol. Its IUPAC name is [(3S,5S,8R,9S,10S,13S,14S,16S)-16-acetamido-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,5S,8R,9S,10S,13S,14S,16S)-16-acetamido-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 15541547 |
| Molecular Formula | C23H35NO4 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.26 |
| IUPAC Name | [(3S,5S,8R,9S,10S,13S,14S,16S)-16-acetamido-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)N[C@H]1C[C@H]2[C@@H]3CC[C@H]4C[C@@H](OC(C)=O)CC[C@]4(C)[C@H]3CC[C@]2(C)C1=O |
| InChI | InChI=1S/C23H35NO4/c1-13(25)24-20-12-19-17-6-5-15-11-16(28-14(2)26)7-9-22(15,3)18(17)8-10-23(19,4)21(20)27/h15-20H,5-12H2,1-4H3,(H,24,25)/t15-,16-,17+,18-,19-,20-,22-,23-/m0/s1 |
| InChIKey | AJJWEOLAELAJIZ-MBHITDIOSA-N |
| XLogP | 3.64 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |