C29H41FO2 — CID 155415601
1-[(3S,3aS,5aR,9aR,9bS)-7-[(2S)-2-hydroxyhexyl]-3a-methyl-1,2,3,4,5,5a,6,9,9a,9b-decahydrocyclopenta[a]naphthalen-3-yl]-3-(4-fluorophenyl)propan-1-one (PubChem CID 155415601) has the molecular formula C29H41FO2 and a molecular weight of 440.64 g/mol. Its IUPAC name is 1-[(3S,3aS,5aR,9aR,9bS)-7-[(2S)-2-hydroxyhexyl]-3a-methyl-1,2,3,4,5,5a,6,9,9a,9b-decahydrocyclopenta[a]naphthalen-3-yl]-3-(4-fluorophenyl)propan-1-one.
| Compound Name | 1-[(3S,3aS,5aR,9aR,9bS)-7-[(2S)-2-hydroxyhexyl]-3a-methyl-1,2,3,4,5,5a,6,9,9a,9b-decahydrocyclopenta[a]naphthalen-3-yl]-3-(4-fluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 155415601 |
| Molecular Formula | C29H41FO2 |
| Molecular Weight | 440.64 g/mol |
| Exact Mass | 440.31 |
| IUPAC Name | 1-[(3S,3aS,5aR,9aR,9bS)-7-[(2S)-2-hydroxyhexyl]-3a-methyl-1,2,3,4,5,5a,6,9,9a,9b-decahydrocyclopenta[a]naphthalen-3-yl]-3-(4-fluorophenyl)propan-1-one |
| SMILES | CCCC[C@H](O)CC1=CC[C@@H]2[C@H](CC[C@]3(C)[C@@H](C(=O)CCc4ccc(F)cc4)CC[C@@H]23)C1 |
| InChI | InChI=1S/C29H41FO2/c1-3-4-5-24(31)19-21-8-12-25-22(18-21)16-17-29(2)26(25)13-14-27(29)28(32)15-9-20-6-10-23(30)11-7-20/h6-8,10-11,22,24-27,31H,3-5,9,12-19H2,1-2H3/t22-,24+,25-,26+,27-,29+/m1/s1 |
| InChIKey | RULKNCSDSNANMT-SPJHJIIVSA-N |
| XLogP | 7.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.64 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|