C22H18Cl3F3N2O3S — CID 155415888
2-methyl-N-(2-oxooxathiolan-4-yl)-4-[3-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-5-yl]benzamide (PubChem CID 155415888) has the molecular formula C22H18Cl3F3N2O3S and a molecular weight of 553.82 g/mol. Its IUPAC name is 2-methyl-N-(2-oxooxathiolan-4-yl)-4-[3-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-5-yl]benzamide.
| Compound Name | 2-methyl-N-(2-oxooxathiolan-4-yl)-4-[3-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-5-yl]benzamide |
|---|---|
| PubChem CID | 155415888 |
| Molecular Formula | C22H18Cl3F3N2O3S |
| Molecular Weight | 553.82 g/mol |
| Exact Mass | 552.01 |
| IUPAC Name | 2-methyl-N-(2-oxooxathiolan-4-yl)-4-[3-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-5-yl]benzamide |
| SMILES | Cc1cc(C2=NCC(c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)ccc1C(=O)NC1COS(=O)C1 |
| InChI | InChI=1S/C22H18Cl3F3N2O3S/c1-11-4-12(2-3-15(11)20(31)30-14-8-33-34(32)9-14)18-7-21(10-29-18,22(26,27)28)13-5-16(23)19(25)17(24)6-13/h2-6,14H,7-10H2,1H3,(H,30,31) |
| InChIKey | LARPYAOYKXASBR-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.82 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|