About 2-[6-(dipyridin-3-ylamino)pyren-1-yl]ethene-1,1,2-tricarbonitrile
2-[6-(dipyridin-3-ylamino)pyren-1-yl]ethene-1,1,2-tricarbonitrile (PubChem CID 155416180) has the molecular formula C31H16N6
and a molecular weight of 472.51 g/mol. Its IUPAC name is 2-[6-(dipyridin-3-ylamino)pyren-1-yl]ethene-1,1,2-tricarbonitrile.
Molecular Properties
| Compound Name | 2-[6-(dipyridin-3-ylamino)pyren-1-yl]ethene-1,1,2-tricarbonitrile |
| PubChem CID | 155416180 |
| Molecular Formula | C31H16N6 |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 2-[6-(dipyridin-3-ylamino)pyren-1-yl]ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)c1ccc2ccc3c(N(c4cccnc4)c4cccnc4)ccc4ccc1c2c43 |
| InChI | InChI=1S/C31H16N6/c32-15-22(16-33)28(17-34)25-9-5-20-7-11-27-29(12-8-21-6-10-26(25)30(20)31(21)27)37(23-3-1-13-35-18-23)24-4-2-14-36-19-24/h1-14,18-19H |
| InChIKey | WJCBWVDNUZPRKS-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 100.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-[6-(dipyridin-3-ylamino)pyren-1-yl]ethene-1,1,2-tricarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(dipyridin-3-ylamino)pyren-1-yl]ethene-1,1,2-tricarbonitrile?
The IUPAC name of 2-[6-(dipyridin-3-ylamino)pyren-1-yl]ethene-1,1,2-tricarbonitrile (CID 155416180) is 2-[6-(dipyridin-3-ylamino)pyren-1-yl]ethene-1,1,2-tricarbonitrile.
What is the SMILES notation for 2-[6-(dipyridin-3-ylamino)pyren-1-yl]ethene-1,1,2-tricarbonitrile?
The canonical SMILES for 2-[6-(dipyridin-3-ylamino)pyren-1-yl]ethene-1,1,2-tricarbonitrile is N#CC(C#N)=C(C#N)c1ccc2ccc3c(N(c4cccnc4)c4cccnc4)ccc4ccc1c2c43.
What is the InChIKey of 2-[6-(dipyridin-3-ylamino)pyren-1-yl]ethene-1,1,2-tricarbonitrile?
The InChIKey is WJCBWVDNUZPRKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H16N6/c32-15-22(16-33)28(17-34)25-9-5-20-7-11-27-29(12-8-21-6-10-26(25)30(20)31(21)27)37(23-3-1-13-35-18-23)24-4-2-14-36-19-24/h1-14,18-19H.
What are the key properties of 2-[6-(dipyridin-3-ylamino)pyren-1-yl]ethene-1,1,2-tricarbonitrile?
2-[6-(dipyridin-3-ylamino)pyren-1-yl]ethene-1,1,2-tricarbonitrile has a molecular weight of 472.51 g/mol, XLogP of 7.17, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(dipyridin-3-ylamino)pyren-1-yl]ethene-1,1,2-tricarbonitrile is sourced from PubChem (CID 155416180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).