About 3-(cyclopropylmethoxy)-5,5-dimethyl-4-(4-methylsulfanylphenyl)furan-2-one
3-(cyclopropylmethoxy)-5,5-dimethyl-4-(4-methylsulfanylphenyl)furan-2-one (PubChem CID 155416237) has the molecular formula C17H20O3S
and a molecular weight of 304.41 g/mol. Its IUPAC name is 3-(cyclopropylmethoxy)-5,5-dimethyl-4-(4-methylsulfanylphenyl)furan-2-one.
Molecular Properties
| Compound Name | 3-(cyclopropylmethoxy)-5,5-dimethyl-4-(4-methylsulfanylphenyl)furan-2-one |
| PubChem CID | 155416237 |
| Molecular Formula | C17H20O3S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 3-(cyclopropylmethoxy)-5,5-dimethyl-4-(4-methylsulfanylphenyl)furan-2-one |
| SMILES | CSc1ccc(C2=C(OCC3CC3)C(=O)OC2(C)C)cc1 |
| InChI | InChI=1S/C17H20O3S/c1-17(2)14(12-6-8-13(21-3)9-7-12)15(16(18)20-17)19-10-11-4-5-11/h6-9,11H,4-5,10H2,1-3H3 |
| InChIKey | ZHLSYOYFOQXGSZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(cyclopropylmethoxy)-5,5-dimethyl-4-(4-methylsulfanylphenyl)furan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclopropylmethoxy)-5,5-dimethyl-4-(4-methylsulfanylphenyl)furan-2-one?
The IUPAC name of 3-(cyclopropylmethoxy)-5,5-dimethyl-4-(4-methylsulfanylphenyl)furan-2-one (CID 155416237) is 3-(cyclopropylmethoxy)-5,5-dimethyl-4-(4-methylsulfanylphenyl)furan-2-one.
What is the SMILES notation for 3-(cyclopropylmethoxy)-5,5-dimethyl-4-(4-methylsulfanylphenyl)furan-2-one?
The canonical SMILES for 3-(cyclopropylmethoxy)-5,5-dimethyl-4-(4-methylsulfanylphenyl)furan-2-one is CSc1ccc(C2=C(OCC3CC3)C(=O)OC2(C)C)cc1.
What is the InChIKey of 3-(cyclopropylmethoxy)-5,5-dimethyl-4-(4-methylsulfanylphenyl)furan-2-one?
The InChIKey is ZHLSYOYFOQXGSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O3S/c1-17(2)14(12-6-8-13(21-3)9-7-12)15(16(18)20-17)19-10-11-4-5-11/h6-9,11H,4-5,10H2,1-3H3.
What are the key properties of 3-(cyclopropylmethoxy)-5,5-dimethyl-4-(4-methylsulfanylphenyl)furan-2-one?
3-(cyclopropylmethoxy)-5,5-dimethyl-4-(4-methylsulfanylphenyl)furan-2-one has a molecular weight of 304.41 g/mol, XLogP of 3.88, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclopropylmethoxy)-5,5-dimethyl-4-(4-methylsulfanylphenyl)furan-2-one is sourced from PubChem (CID 155416237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).