About 7-ethyl-2-propan-2-yl-1-azacycloocta-1,3,4-triene
7-ethyl-2-propan-2-yl-1-azacycloocta-1,3,4-triene (PubChem CID 155416249) has the molecular formula C12H19N
and a molecular weight of 177.29 g/mol. Its IUPAC name is 7-ethyl-2-propan-2-yl-1-azacycloocta-1,3,4-triene.
Molecular Properties
| Compound Name | 7-ethyl-2-propan-2-yl-1-azacycloocta-1,3,4-triene |
| PubChem CID | 155416249 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 7-ethyl-2-propan-2-yl-1-azacycloocta-1,3,4-triene |
| SMILES | CCC1CC=C=C/C(C(C)C)=N\C1 |
| InChI | InChI=1S/C12H19N/c1-4-11-7-5-6-8-12(10(2)3)13-9-11/h5,8,10-11H,4,7,9H2,1-3H3/b13-12+ |
| InChIKey | XXHJWNDKROGHFC-OUKQBFOZSA-N |
| XLogP | 3.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-ethyl-2-propan-2-yl-1-azacycloocta-1,3,4-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-2-propan-2-yl-1-azacycloocta-1,3,4-triene?
The IUPAC name of 7-ethyl-2-propan-2-yl-1-azacycloocta-1,3,4-triene (CID 155416249) is 7-ethyl-2-propan-2-yl-1-azacycloocta-1,3,4-triene.
What is the SMILES notation for 7-ethyl-2-propan-2-yl-1-azacycloocta-1,3,4-triene?
The canonical SMILES for 7-ethyl-2-propan-2-yl-1-azacycloocta-1,3,4-triene is CCC1CC=C=C/C(C(C)C)=N\C1.
What is the InChIKey of 7-ethyl-2-propan-2-yl-1-azacycloocta-1,3,4-triene?
The InChIKey is XXHJWNDKROGHFC-OUKQBFOZSA-N. The full InChI is InChI=1S/C12H19N/c1-4-11-7-5-6-8-12(10(2)3)13-9-11/h5,8,10-11H,4,7,9H2,1-3H3/b13-12+.
What are the key properties of 7-ethyl-2-propan-2-yl-1-azacycloocta-1,3,4-triene?
7-ethyl-2-propan-2-yl-1-azacycloocta-1,3,4-triene has a molecular weight of 177.29 g/mol, XLogP of 3.22, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-2-propan-2-yl-1-azacycloocta-1,3,4-triene is sourced from PubChem (CID 155416249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).