C14H24N2O — CID 155416268
N-ethyl-N'-[(3Z,5E)-6-methoxy-3-methylocta-3,5,7-trien-4-yl]-N-methylmethanimidamide (PubChem CID 155416268) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is N-ethyl-N'-[(3Z,5E)-6-methoxy-3-methylocta-3,5,7-trien-4-yl]-N-methylmethanimidamide.
| Compound Name | N-ethyl-N'-[(3Z,5E)-6-methoxy-3-methylocta-3,5,7-trien-4-yl]-N-methylmethanimidamide |
|---|---|
| PubChem CID | 155416268 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | N-ethyl-N'-[(3Z,5E)-6-methoxy-3-methylocta-3,5,7-trien-4-yl]-N-methylmethanimidamide |
| SMILES | C=C/C(=C\C(\N=C\N(C)CC)=C(/C)CC)OC |
| InChI | InChI=1S/C14H24N2O/c1-7-12(4)14(10-13(8-2)17-6)15-11-16(5)9-3/h8,10-11H,2,7,9H2,1,3-6H3/b13-10+,14-12-,15-11+ |
| InChIKey | KJCFZOPSJWDLJN-BCPVJRNGSA-N |
| XLogP | 3.37 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|