About (3-butoxy-3-methylbutyl) methanesulfonate
(3-butoxy-3-methylbutyl) methanesulfonate (PubChem CID 155416347) has the molecular formula C10H22O4S
and a molecular weight of 238.35 g/mol. Its IUPAC name is (3-butoxy-3-methylbutyl) methanesulfonate.
Molecular Properties
| Compound Name | (3-butoxy-3-methylbutyl) methanesulfonate |
| PubChem CID | 155416347 |
| Molecular Formula | C10H22O4S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (3-butoxy-3-methylbutyl) methanesulfonate |
| SMILES | CCCCOC(C)(C)CCOS(C)(=O)=O |
| InChI | InChI=1S/C10H22O4S/c1-5-6-8-13-10(2,3)7-9-14-15(4,11)12/h5-9H2,1-4H3 |
| InChIKey | CSBXQRKSMUUYIC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3-butoxy-3-methylbutyl) methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-butoxy-3-methylbutyl) methanesulfonate?
The IUPAC name of (3-butoxy-3-methylbutyl) methanesulfonate (CID 155416347) is (3-butoxy-3-methylbutyl) methanesulfonate.
What is the SMILES notation for (3-butoxy-3-methylbutyl) methanesulfonate?
The canonical SMILES for (3-butoxy-3-methylbutyl) methanesulfonate is CCCCOC(C)(C)CCOS(C)(=O)=O.
What is the InChIKey of (3-butoxy-3-methylbutyl) methanesulfonate?
The InChIKey is CSBXQRKSMUUYIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O4S/c1-5-6-8-13-10(2,3)7-9-14-15(4,11)12/h5-9H2,1-4H3.
What are the key properties of (3-butoxy-3-methylbutyl) methanesulfonate?
(3-butoxy-3-methylbutyl) methanesulfonate has a molecular weight of 238.35 g/mol, XLogP of 1.95, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-butoxy-3-methylbutyl) methanesulfonate is sourced from PubChem (CID 155416347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).