About (5Z,7E)-1-ethyl-7-(trifluoromethyl)-3,4-dihydroazocin-2-one
(5Z,7E)-1-ethyl-7-(trifluoromethyl)-3,4-dihydroazocin-2-one (PubChem CID 155416526) has the molecular formula C10H12F3NO
and a molecular weight of 219.21 g/mol. Its IUPAC name is (5Z,7E)-1-ethyl-7-(trifluoromethyl)-3,4-dihydroazocin-2-one.
Molecular Properties
| Compound Name | (5Z,7E)-1-ethyl-7-(trifluoromethyl)-3,4-dihydroazocin-2-one |
| PubChem CID | 155416526 |
| Molecular Formula | C10H12F3NO |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | (5Z,7E)-1-ethyl-7-(trifluoromethyl)-3,4-dihydroazocin-2-one |
| SMILES | CCN1/C=C(C(F)(F)F)\C=C/CCC1=O |
| InChI | InChI=1S/C10H12F3NO/c1-2-14-7-8(10(11,12)13)5-3-4-6-9(14)15/h3,5,7H,2,4,6H2,1H3/b5-3-,8-7+ |
| InChIKey | XEGLSTSZEWSYQY-ZIQCHISCSA-N |
| XLogP | 2.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5Z,7E)-1-ethyl-7-(trifluoromethyl)-3,4-dihydroazocin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z,7E)-1-ethyl-7-(trifluoromethyl)-3,4-dihydroazocin-2-one?
The IUPAC name of (5Z,7E)-1-ethyl-7-(trifluoromethyl)-3,4-dihydroazocin-2-one (CID 155416526) is (5Z,7E)-1-ethyl-7-(trifluoromethyl)-3,4-dihydroazocin-2-one.
What is the SMILES notation for (5Z,7E)-1-ethyl-7-(trifluoromethyl)-3,4-dihydroazocin-2-one?
The canonical SMILES for (5Z,7E)-1-ethyl-7-(trifluoromethyl)-3,4-dihydroazocin-2-one is CCN1/C=C(C(F)(F)F)\C=C/CCC1=O.
What is the InChIKey of (5Z,7E)-1-ethyl-7-(trifluoromethyl)-3,4-dihydroazocin-2-one?
The InChIKey is XEGLSTSZEWSYQY-ZIQCHISCSA-N. The full InChI is InChI=1S/C10H12F3NO/c1-2-14-7-8(10(11,12)13)5-3-4-6-9(14)15/h3,5,7H,2,4,6H2,1H3/b5-3-,8-7+.
What are the key properties of (5Z,7E)-1-ethyl-7-(trifluoromethyl)-3,4-dihydroazocin-2-one?
(5Z,7E)-1-ethyl-7-(trifluoromethyl)-3,4-dihydroazocin-2-one has a molecular weight of 219.21 g/mol, XLogP of 2.63, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z,7E)-1-ethyl-7-(trifluoromethyl)-3,4-dihydroazocin-2-one is sourced from PubChem (CID 155416526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).