C65H53N3 — CID 155416578
2-[3-[2-(3,8a-dimethyl-9,9-diphenyl-4,4b-dihydro-3H-fluoren-2-yl)-3-methyl-3,4-dihydronaphthalen-1-yl]phenyl]-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine (PubChem CID 155416578) has the molecular formula C65H53N3 and a molecular weight of 876.16 g/mol. Its IUPAC name is 2-[3-[2-(3,8a-dimethyl-9,9-diphenyl-4,4b-dihydro-3H-fluoren-2-yl)-3-methyl-3,4-dihydronaphthalen-1-yl]phenyl]-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[3-[2-(3,8a-dimethyl-9,9-diphenyl-4,4b-dihydro-3H-fluoren-2-yl)-3-methyl-3,4-dihydronaphthalen-1-yl]phenyl]-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 155416578 |
| Molecular Formula | C65H53N3 |
| Molecular Weight | 876.16 g/mol |
| Exact Mass | 875.42 |
| IUPAC Name | 2-[3-[2-(3,8a-dimethyl-9,9-diphenyl-4,4b-dihydro-3H-fluoren-2-yl)-3-methyl-3,4-dihydronaphthalen-1-yl]phenyl]-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine |
| SMILES | CC1CC2=C(C=C1C1=C(c3cccc(-c4nc(-c5ccccc5)nc(-c5cccc(-c6ccccc6)c5)n4)c3)c3ccccc3CC1C)C(c1ccccc1)(c1ccccc1)C1(C)C=CC=CC21 |
| InChI | InChI=1S/C65H53N3/c1-43-39-56-57-36-18-19-37-64(57,3)65(52-31-12-6-13-32-52,53-33-14-7-15-34-53)58(56)42-55(43)59-44(2)38-48-26-16-17-35-54(48)60(59)49-28-21-30-51(41-49)63-67-61(46-24-10-5-11-25-46)66-62(68-63)50-29-20-27-47(40-50)45-22-8-4-9-23-45/h4-37,40-44,57H,38-39H2,1-3H3 |
| InChIKey | VKZGYZALCBDFGE-UHFFFAOYSA-N |
| XLogP | 15.54 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 876.16 |
| LogP ≤ 5 | 15.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |