C11H18F3N3 — CID 155416878
N'-[5-ethyl-3-(trifluoromethyl)-2,3-dihydropyridin-6-yl]-N-methylethane-1,2-diamine (PubChem CID 155416878) has the molecular formula C11H18F3N3 and a molecular weight of 249.28 g/mol. Its IUPAC name is N'-[5-ethyl-3-(trifluoromethyl)-2,3-dihydropyridin-6-yl]-N-methylethane-1,2-diamine.
| Compound Name | N'-[5-ethyl-3-(trifluoromethyl)-2,3-dihydropyridin-6-yl]-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 155416878 |
| Molecular Formula | C11H18F3N3 |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | N'-[5-ethyl-3-(trifluoromethyl)-2,3-dihydropyridin-6-yl]-N-methylethane-1,2-diamine |
| SMILES | CCC1=CC(C(F)(F)F)CN=C1NCCNC |
| InChI | InChI=1S/C11H18F3N3/c1-3-8-6-9(11(12,13)14)7-17-10(8)16-5-4-15-2/h6,9,15H,3-5,7H2,1-2H3,(H,16,17) |
| InChIKey | ZUBKMWGDCJRKRN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|