C10H13F4NO — CID 155416941
2-[(2Z,4Z)-2-fluoro-6-(trifluoromethyl)hepta-2,4,6-trien-3-yl]oxyethanamine (PubChem CID 155416941) has the molecular formula C10H13F4NO and a molecular weight of 239.21 g/mol. Its IUPAC name is 2-[(2Z,4Z)-2-fluoro-6-(trifluoromethyl)hepta-2,4,6-trien-3-yl]oxyethanamine.
| Compound Name | 2-[(2Z,4Z)-2-fluoro-6-(trifluoromethyl)hepta-2,4,6-trien-3-yl]oxyethanamine |
|---|---|
| PubChem CID | 155416941 |
| Molecular Formula | C10H13F4NO |
| Molecular Weight | 239.21 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 2-[(2Z,4Z)-2-fluoro-6-(trifluoromethyl)hepta-2,4,6-trien-3-yl]oxyethanamine |
| SMILES | C=C(/C=C\C(OCCN)=C(/C)F)C(F)(F)F |
| InChI | InChI=1S/C10H13F4NO/c1-7(10(12,13)14)3-4-9(8(2)11)16-6-5-15/h3-4H,1,5-6,15H2,2H3/b4-3-,9-8- |
| InChIKey | XIEZFFLJOMRKMS-JYKTZQBOSA-N |
| XLogP | 2.84 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.21 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|