C14H19NS — CID 155417044
(3Z,5E)-5-[(2-methylcyclohexa-1,5-dien-1-yl)amino]hepta-3,5-diene-2-thione (PubChem CID 155417044) has the molecular formula C14H19NS and a molecular weight of 233.38 g/mol. Its IUPAC name is (3Z,5E)-5-[(2-methylcyclohexa-1,5-dien-1-yl)amino]hepta-3,5-diene-2-thione.
| Compound Name | (3Z,5E)-5-[(2-methylcyclohexa-1,5-dien-1-yl)amino]hepta-3,5-diene-2-thione |
|---|---|
| PubChem CID | 155417044 |
| Molecular Formula | C14H19NS |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | (3Z,5E)-5-[(2-methylcyclohexa-1,5-dien-1-yl)amino]hepta-3,5-diene-2-thione |
| SMILES | C/C=C(\C=C/C(C)=S)NC1=C(C)CCC=C1 |
| InChI | InChI=1S/C14H19NS/c1-4-13(10-9-12(3)16)15-14-8-6-5-7-11(14)2/h4,6,8-10,15H,5,7H2,1-3H3/b10-9-,13-4+ |
| InChIKey | CEGWGEMCDKDZFF-BYFILKBQSA-N |
| XLogP | 4.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|