C16H16F4O2 — CID 155417065
(1S)-2-[(2Z,4E)-4-fluoro-6-methylhepta-2,4,6-trienoxy]-4-(trifluoromethyl)cyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 155417065) has the molecular formula C16H16F4O2 and a molecular weight of 316.29 g/mol. Its IUPAC name is (1S)-2-[(2Z,4E)-4-fluoro-6-methylhepta-2,4,6-trienoxy]-4-(trifluoromethyl)cyclohexa-2,4-diene-1-carbaldehyde.
| Compound Name | (1S)-2-[(2Z,4E)-4-fluoro-6-methylhepta-2,4,6-trienoxy]-4-(trifluoromethyl)cyclohexa-2,4-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 155417065 |
| Molecular Formula | C16H16F4O2 |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (1S)-2-[(2Z,4E)-4-fluoro-6-methylhepta-2,4,6-trienoxy]-4-(trifluoromethyl)cyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | C=C(C)/C=C(F)\C=C/COC1=CC(C(F)(F)F)=CC[C@@H]1C=O |
| InChI | InChI=1S/C16H16F4O2/c1-11(2)8-14(17)4-3-7-22-15-9-13(16(18,19)20)6-5-12(15)10-21/h3-4,6,8-10,12H,1,5,7H2,2H3/b4-3-,14-8+/t12-/m1/s1 |
| InChIKey | RAVRZHREJUOPNZ-NHPCZMDCSA-N |
| XLogP | 4.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|