About 3-[(1Z)-buta-1,3-dienyl]-2-methyl-6H-furo[3,2-c]carbazole
3-[(1Z)-buta-1,3-dienyl]-2-methyl-6H-furo[3,2-c]carbazole (PubChem CID 155417425) has the molecular formula C19H15NO
and a molecular weight of 273.34 g/mol. Its IUPAC name is 3-[(1Z)-buta-1,3-dienyl]-2-methyl-6H-furo[3,2-c]carbazole.
Molecular Properties
| Compound Name | 3-[(1Z)-buta-1,3-dienyl]-2-methyl-6H-furo[3,2-c]carbazole |
| PubChem CID | 155417425 |
| Molecular Formula | C19H15NO |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 3-[(1Z)-buta-1,3-dienyl]-2-methyl-6H-furo[3,2-c]carbazole |
| SMILES | C=C/C=C\c1c(C)oc2c1ccc1[nH]c3ccccc3c12 |
| InChI | InChI=1S/C19H15NO/c1-3-4-7-13-12(2)21-19-14(13)10-11-17-18(19)15-8-5-6-9-16(15)20-17/h3-11,20H,1H2,2H3/b7-4- |
| InChIKey | AUCANRVHRQGBCT-DAXSKMNVSA-N |
| XLogP | 5.57 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1Z)-buta-1,3-dienyl]-2-methyl-6H-furo[3,2-c]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1Z)-buta-1,3-dienyl]-2-methyl-6H-furo[3,2-c]carbazole?
The IUPAC name of 3-[(1Z)-buta-1,3-dienyl]-2-methyl-6H-furo[3,2-c]carbazole (CID 155417425) is 3-[(1Z)-buta-1,3-dienyl]-2-methyl-6H-furo[3,2-c]carbazole.
What is the SMILES notation for 3-[(1Z)-buta-1,3-dienyl]-2-methyl-6H-furo[3,2-c]carbazole?
The canonical SMILES for 3-[(1Z)-buta-1,3-dienyl]-2-methyl-6H-furo[3,2-c]carbazole is C=C/C=C\c1c(C)oc2c1ccc1[nH]c3ccccc3c12.
What is the InChIKey of 3-[(1Z)-buta-1,3-dienyl]-2-methyl-6H-furo[3,2-c]carbazole?
The InChIKey is AUCANRVHRQGBCT-DAXSKMNVSA-N. The full InChI is InChI=1S/C19H15NO/c1-3-4-7-13-12(2)21-19-14(13)10-11-17-18(19)15-8-5-6-9-16(15)20-17/h3-11,20H,1H2,2H3/b7-4-.
What are the key properties of 3-[(1Z)-buta-1,3-dienyl]-2-methyl-6H-furo[3,2-c]carbazole?
3-[(1Z)-buta-1,3-dienyl]-2-methyl-6H-furo[3,2-c]carbazole has a molecular weight of 273.34 g/mol, XLogP of 5.57, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1Z)-buta-1,3-dienyl]-2-methyl-6H-furo[3,2-c]carbazole is sourced from PubChem (CID 155417425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).