About [3,4-dimethoxy-2-[(2R)-6-methylhept-5-en-2-yl]cyclohexyl]methanol
[3,4-dimethoxy-2-[(2R)-6-methylhept-5-en-2-yl]cyclohexyl]methanol (PubChem CID 155417438) has the molecular formula C17H32O3
and a molecular weight of 284.44 g/mol. Its IUPAC name is [3,4-dimethoxy-2-[(2R)-6-methylhept-5-en-2-yl]cyclohexyl]methanol.
Molecular Properties
| Compound Name | [3,4-dimethoxy-2-[(2R)-6-methylhept-5-en-2-yl]cyclohexyl]methanol |
| PubChem CID | 155417438 |
| Molecular Formula | C17H32O3 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.24 |
| IUPAC Name | [3,4-dimethoxy-2-[(2R)-6-methylhept-5-en-2-yl]cyclohexyl]methanol |
| SMILES | COC1CCC(CO)C(C(C)CCC=C(C)C)C1OC |
| InChI | InChI=1S/C17H32O3/c1-12(2)7-6-8-13(3)16-14(11-18)9-10-15(19-4)17(16)20-5/h7,13-18H,6,8-11H2,1-5H3 |
| InChIKey | YYLNBSOYJDOXEB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [3,4-dimethoxy-2-[(2R)-6-methylhept-5-en-2-yl]cyclohexyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,4-dimethoxy-2-[(2R)-6-methylhept-5-en-2-yl]cyclohexyl]methanol?
The IUPAC name of [3,4-dimethoxy-2-[(2R)-6-methylhept-5-en-2-yl]cyclohexyl]methanol (CID 155417438) is [3,4-dimethoxy-2-[(2R)-6-methylhept-5-en-2-yl]cyclohexyl]methanol.
What is the SMILES notation for [3,4-dimethoxy-2-[(2R)-6-methylhept-5-en-2-yl]cyclohexyl]methanol?
The canonical SMILES for [3,4-dimethoxy-2-[(2R)-6-methylhept-5-en-2-yl]cyclohexyl]methanol is COC1CCC(CO)C(C(C)CCC=C(C)C)C1OC.
What is the InChIKey of [3,4-dimethoxy-2-[(2R)-6-methylhept-5-en-2-yl]cyclohexyl]methanol?
The InChIKey is YYLNBSOYJDOXEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32O3/c1-12(2)7-6-8-13(3)16-14(11-18)9-10-15(19-4)17(16)20-5/h7,13-18H,6,8-11H2,1-5H3.
What are the key properties of [3,4-dimethoxy-2-[(2R)-6-methylhept-5-en-2-yl]cyclohexyl]methanol?
[3,4-dimethoxy-2-[(2R)-6-methylhept-5-en-2-yl]cyclohexyl]methanol has a molecular weight of 284.44 g/mol, XLogP of 3.42, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3,4-dimethoxy-2-[(2R)-6-methylhept-5-en-2-yl]cyclohexyl]methanol is sourced from PubChem (CID 155417438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).