C20H37NS — CID 155417462
2-[(3E)-5-(2,2-dimethylpropyl)-7-methylocta-3,7-dienyl]sulfanyl-4-methylpent-1-en-3-amine (PubChem CID 155417462) has the molecular formula C20H37NS and a molecular weight of 323.59 g/mol. Its IUPAC name is 2-[(3E)-5-(2,2-dimethylpropyl)-7-methylocta-3,7-dienyl]sulfanyl-4-methylpent-1-en-3-amine.
| Compound Name | 2-[(3E)-5-(2,2-dimethylpropyl)-7-methylocta-3,7-dienyl]sulfanyl-4-methylpent-1-en-3-amine |
|---|---|
| PubChem CID | 155417462 |
| Molecular Formula | C20H37NS |
| Molecular Weight | 323.59 g/mol |
| Exact Mass | 323.26 |
| IUPAC Name | 2-[(3E)-5-(2,2-dimethylpropyl)-7-methylocta-3,7-dienyl]sulfanyl-4-methylpent-1-en-3-amine |
| SMILES | C=C(C)CC(/C=C/CCSC(=C)C(N)C(C)C)CC(C)(C)C |
| InChI | InChI=1S/C20H37NS/c1-15(2)13-18(14-20(6,7)8)11-9-10-12-22-17(5)19(21)16(3)4/h9,11,16,18-19H,1,5,10,12-14,21H2,2-4,6-8H3/b11-9+ |
| InChIKey | BVMAPHFHDKIHSB-PKNBQFBNSA-N |
| XLogP | 6.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.59 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|