About (2E)-4-[[(Z)-but-2-en-2-yl]iminomethyl]-3-methylpenta-2,4-diene-2-sulfonamide
(2E)-4-[[(Z)-but-2-en-2-yl]iminomethyl]-3-methylpenta-2,4-diene-2-sulfonamide (PubChem CID 155417604) has the molecular formula C11H18N2O2S
and a molecular weight of 242.34 g/mol. Its IUPAC name is (2E)-4-[[(Z)-but-2-en-2-yl]iminomethyl]-3-methylpenta-2,4-diene-2-sulfonamide.
Molecular Properties
| Compound Name | (2E)-4-[[(Z)-but-2-en-2-yl]iminomethyl]-3-methylpenta-2,4-diene-2-sulfonamide |
| PubChem CID | 155417604 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | (2E)-4-[[(Z)-but-2-en-2-yl]iminomethyl]-3-methylpenta-2,4-diene-2-sulfonamide |
| SMILES | C=C(/C=N/C(C)=C\C)/C(C)=C(\C)S(N)(=O)=O |
| InChI | InChI=1S/C11H18N2O2S/c1-6-9(3)13-7-8(2)10(4)11(5)16(12,14)15/h6-7H,2H2,1,3-5H3,(H2,12,14,15)/b9-6-,11-10+,13-7+ |
| InChIKey | MIGUEILQUNBZDU-OATGDJTBSA-N |
| XLogP | 2.12 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-4-[[(Z)-but-2-en-2-yl]iminomethyl]-3-methylpenta-2,4-diene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-4-[[(Z)-but-2-en-2-yl]iminomethyl]-3-methylpenta-2,4-diene-2-sulfonamide?
The IUPAC name of (2E)-4-[[(Z)-but-2-en-2-yl]iminomethyl]-3-methylpenta-2,4-diene-2-sulfonamide (CID 155417604) is (2E)-4-[[(Z)-but-2-en-2-yl]iminomethyl]-3-methylpenta-2,4-diene-2-sulfonamide.
What is the SMILES notation for (2E)-4-[[(Z)-but-2-en-2-yl]iminomethyl]-3-methylpenta-2,4-diene-2-sulfonamide?
The canonical SMILES for (2E)-4-[[(Z)-but-2-en-2-yl]iminomethyl]-3-methylpenta-2,4-diene-2-sulfonamide is C=C(/C=N/C(C)=C\C)/C(C)=C(\C)S(N)(=O)=O.
What is the InChIKey of (2E)-4-[[(Z)-but-2-en-2-yl]iminomethyl]-3-methylpenta-2,4-diene-2-sulfonamide?
The InChIKey is MIGUEILQUNBZDU-OATGDJTBSA-N. The full InChI is InChI=1S/C11H18N2O2S/c1-6-9(3)13-7-8(2)10(4)11(5)16(12,14)15/h6-7H,2H2,1,3-5H3,(H2,12,14,15)/b9-6-,11-10+,13-7+.
What are the key properties of (2E)-4-[[(Z)-but-2-en-2-yl]iminomethyl]-3-methylpenta-2,4-diene-2-sulfonamide?
(2E)-4-[[(Z)-but-2-en-2-yl]iminomethyl]-3-methylpenta-2,4-diene-2-sulfonamide has a molecular weight of 242.34 g/mol, XLogP of 2.12, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-4-[[(Z)-but-2-en-2-yl]iminomethyl]-3-methylpenta-2,4-diene-2-sulfonamide is sourced from PubChem (CID 155417604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).